Draw line-angle structures for the compounds (a) through (h). a. CH 3 (CH 2 ) 3 CH(CH 3 ) 2 b. (CH 3 ) 2 CHCH 2 Cl

Welcome back, everyone. Draw the bond line structures of the following compounds. Let's begin with the first one. It says that we have CH three CH 24 times, followed by CH and CH 32 times. What we can do is thus, we have to recall that each corner and each vertex will represent an implicit carbon atom. So first of all, number one, we have CH three and then we have four CH two groups. So we want to draw four more carbon atoms, we're going to 12, three and for a labeled up the second, the third, the fourth and the fifth, those are the four carbon atoms from each siege two, right? Essentially the reason why we're using a subscript is because it's condensed, right? We don't want to write siege to four times instead of we are writing siege to four. Now, what else do we have? Well, essentially the next carbon, which is carbon six is CH. Why is it c well, essentially it's bonded to siege three, right? Two times, meaning it has two muscle groups attached to it. So what we're going to do is draw two siege three bonded to carbon six. Simply we want to extend two lines from that carbon six because each corner represents an implicit carbon that has three hydrogens. Well, then we have our first structure and now we can move on to the second one. The second structure tells us that there are two metal groups bonded to CH. So let's simply draw two metal groups. All right, now let's draw a line. So we have CH at the intersection point because carbon is for bonded. So there's an implicit hydrogen. Simply speaking, we have C three, right C three CH at the corner and that C is followed by three times CH two. So we're going to draw three carbon atoms. So one to and three and finally, at the end of the chain, we're drawing bromine. So let's double check it siege 32 times bonded to CH, then we have siege to three times and finally, Bromine. Well, then that's the correct structure. We don't want to show any carbon or hydrogen atoms. That's why we need to clean it up a bit and we can label our final answer. Thank you for watching.

Table of contents

Skip topic navigation

1. A Review of General Chemistry5h 5m
2. Molecular Representations1h 14m
3. Acids and Bases2h 46m
4. Alkanes and Cycloalkanes4h 17m
5. Chirality3h 39m
6. Thermodynamics and Kinetics1h 22m
7. Substitution Reactions1h 48m
8. Elimination Reactions2h 30m
9. Alkenes and Alkynes2h 9m
10. Addition Reactions3h 19m
11. Radical Reactions1h 58m
12. Alcohols, Ethers, Epoxides and Thiols2h 42m
13. Alcohols and Carbonyl Compounds2h 17m
14. Synthetic Techniques1h 26m
15. Analytical Techniques:IR, NMR, Mass Spect7h 3m
16. Conjugated Systems6h 13m
17. Ultraviolet Spectroscopy51m
18. Aromaticity2h 34m
19. Reactions of Aromatics: EAS and Beyond5h 1m
20. Phenols55m
21. Aldehydes and Ketones: Nucleophilic Addition4h 56m
22. Carboxylic Acid Derivatives: NAS2h 51m
23. The Chemistry of Thioesters, Phophate Ester and Phosphate Anhydrides1h 10m
24. Enolate Chemistry: Reactions at the Alpha-Carbon1h 53m
25. Condensation Chemistry2h 9m
26. Amines1h 43m
27. Heterocycles2h 0m
28. Carbohydrates5h 53m
29. Amino Acids4h 20m
30. Peptides and Proteins2h 42m
31. Catalysis in Organic Reactions1h 30m
32. Lipids 2h 50m
33. The Organic Chemistry of Metabolic Pathways2h 52m
34. Nucleic Acids1h 32m
35. Transition Metals6h 14m
36. Synthetic Polymers1h 49m

1. A Review of General Chemistry

Condensed Structural Formula

Organic Chemistry

1. A Review of General Chemistry

Condensed Structural Formula

Previous problemNext problem

3:25 minutes

Problem 13a,b

Textbook Question

Draw line-angle structures for the compounds (a) through (h).
a. CH₃(CH₂)₃CH(CH₃)₂
b. (CH₃)₂CHCH₂Cl

Verified step by step guidance

Step 1: Understand the line-angle structure representation. In organic chemistry, line-angle structures are a simplified way to depict molecules. Each vertex represents a carbon atom, and lines represent bonds between them. Hydrogen atoms bonded to carbon are usually not shown explicitly.

Step 2: For compound (a) CH3(CH2)3CH(CH3)2, identify the main carbon chain. The longest chain is five carbons long: CH3-CH2-CH2-CH2-CH(CH3)2. The CH(CH3)2 group is a branching point, indicating a methyl group attached to the fourth carbon.

Step 3: Draw the line-angle structure for compound (a). Start with a zigzag line representing the five-carbon chain. At the fourth carbon, add a branch to represent the two methyl groups (CH3) attached to it.

Step 4: For compound (b) (CH3)2CHCH2Cl, identify the main carbon chain. The longest chain is three carbons long: (CH3)2CH-CH2-Cl. The (CH3)2CH group indicates two methyl groups attached to the first carbon.

Step 5: Draw the line-angle structure for compound (b). Start with a zigzag line representing the three-carbon chain. At the first carbon, add branches to represent the two methyl groups. At the third carbon, add a line to represent the chlorine atom (Cl) attached to it.

Verified video answer for a similar problem:

This video solution was recommended by our tutors as helpful for the problem above

Video duration:

Play a video:

Was this helpful?

Key Concepts

Here are the essential concepts you must grasp in order to answer the question correctly.

Line-Angle Structures

Line-angle structures, also known as skeletal structures, are a simplified way of drawing organic molecules. In these diagrams, carbon atoms are represented by the ends and intersections of lines, while hydrogen atoms attached to carbons are usually omitted for clarity. This method helps in visualizing complex organic molecules more easily.

Alkane Nomenclature

Alkane nomenclature involves naming organic compounds based on the number of carbon atoms and the structure of the carbon chain. The longest continuous chain of carbon atoms determines the base name, while substituents are named and numbered according to their position on the chain. Understanding this is crucial for interpreting and drawing structures from molecular formulas.

Substituents and Branching

Substituents are atoms or groups of atoms attached to the main carbon chain, and branching occurs when a carbon atom is connected to more than two other carbon atoms. Recognizing and correctly placing substituents, such as methyl or chloro groups, is essential for accurately drawing and understanding the structure of organic compounds.

Watch next

Master How to interpret condensed structures. with a bite sized video explanation from Johnny

Start learning