The following names are all incorrect or incomplete, but they represent real structures. Draw each structure and name it correctly.
c. 5-chloro-4-methylhexane
d. 2-dimethylbutane
The following names are all incorrect or incomplete, but they represent real structures. Draw each structure and name it correctly.
c. 5-chloro-4-methylhexane
d. 2-dimethylbutane
All of the following names are incorrect or incomplete. In each case, draw the structure (or a possible structure) and name it correctly.
d. 4-isobutylheptane
e. 2-bromo-3-ethylbutane
f. 2,3-diethyl-5-isopropylheptane
Draw the structures of the following compounds.
c. 3,3-diethyl-4-(2,2-dimethylpropyl)octane
Draw the structures of the following compounds.
b. 5-(1,2,2-trimethylpropyl)nonane
Provide IUPAC names for the following compounds.
(d)
(e)
(f)
A student was given the structural formulas of several compounds and was asked to give them systematic names. How many did the student name correctly? Correct those that are misnamed.
h. 5-ethyl-2-methylhexane
A student was given the structural formulas of several compounds and was asked to give them systematic names. How many did the student name correctly? Correct those that are misnamed.
g. 3,3-dichlorooctane
Draw a condensed structure and a skeletal structure for each of the following:
l. 5-isopropyldecane
Draw a condensed structure and a skeletal structure for each of the following:
k. 3,4-dimethyloctane
What is each compound's systematic name?
h.
What is each compound's systematic name?
g. CH3CH2C(CH2CH3)2CH2CH2CH3
Draw skeletal structures for the following:
f. 2,6-dimethyl-4-(2-methylpropyl)decane
Draw skeletal structures for the following:
e. 2-methyl-4-(1-methylethyl)octane
Give the systematic names for all alkanes with molecular formula C7H16 that do not have any secondary hydrogens.
Draw the structure for each of the following:
e. 2,5-dimethyl-4-(2-methylpropyl)octane